C11H12F3N3O3 — CID 139979934
N-[2-(methoxymethoxyimino)ethyl]-4-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 139979934) has the molecular formula C11H12F3N3O3 and a molecular weight of 291.23 g/mol. Its IUPAC name is N-[2-(methoxymethoxyimino)ethyl]-4-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[2-(methoxymethoxyimino)ethyl]-4-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139979934 |
| Molecular Formula | C11H12F3N3O3 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-[2-(methoxymethoxyimino)ethyl]-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | COCON=CCNC(=O)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C11H12F3N3O3/c1-19-7-20-17-5-4-16-10(18)8-6-15-3-2-9(8)11(12,13)14/h2-3,5-6H,4,7H2,1H3,(H,16,18) |
| InChIKey | DMNPRLREOYGBSS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|