C13H9ClF3N3O — CID 87746830
N-[(2-chloro-3-pyridinyl)methyl]-4-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 87746830) has the molecular formula C13H9ClF3N3O and a molecular weight of 315.68 g/mol. Its IUPAC name is N-[(2-chloro-3-pyridinyl)methyl]-4-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[(2-chloro-3-pyridinyl)methyl]-4-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87746830 |
| Molecular Formula | C13H9ClF3N3O |
| Molecular Weight | 315.68 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-[(2-chloro-3-pyridinyl)methyl]-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1cccnc1Cl)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C13H9ClF3N3O/c14-11-8(2-1-4-19-11)6-20-12(21)9-7-18-5-3-10(9)13(15,16)17/h1-5,7H,6H2,(H,20,21) |
| InChIKey | UUEJOXFTBZWALC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.68 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|