C26H16F6N8O4 — CID 162568031
N,N'-bis(pyrimidin-2-ylmethyl)-N,N'-bis[4-(trifluoromethyl)pyridine-3-carbonyl]oxamide (PubChem CID 162568031) has the molecular formula C26H16F6N8O4 and a molecular weight of 618.45 g/mol. Its IUPAC name is N,N'-bis(pyrimidin-2-ylmethyl)-N,N'-bis[4-(trifluoromethyl)pyridine-3-carbonyl]oxamide.
| Compound Name | N,N'-bis(pyrimidin-2-ylmethyl)-N,N'-bis[4-(trifluoromethyl)pyridine-3-carbonyl]oxamide |
|---|---|
| PubChem CID | 162568031 |
| Molecular Formula | C26H16F6N8O4 |
| Molecular Weight | 618.45 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | N,N'-bis(pyrimidin-2-ylmethyl)-N,N'-bis[4-(trifluoromethyl)pyridine-3-carbonyl]oxamide |
| SMILES | O=C(C(=O)N(Cc1ncccn1)C(=O)c1cnccc1C(F)(F)F)N(Cc1ncccn1)C(=O)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C26H16F6N8O4/c27-25(28,29)17-3-9-33-11-15(17)21(41)39(13-19-35-5-1-6-36-19)23(43)24(44)40(14-20-37-7-2-8-38-20)22(42)16-12-34-10-4-18(16)26(30,31)32/h1-12H,13-14H2 |
| InChIKey | JVRWFGUGZKQIFT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 152.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|