C18H16F3N3OS — CID 11372383
prop-2-enyl N'-benzyl-N-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate (PubChem CID 11372383) has the molecular formula C18H16F3N3OS and a molecular weight of 379.41 g/mol. Its IUPAC name is prop-2-enyl N'-benzyl-N-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate.
| Compound Name | prop-2-enyl N'-benzyl-N-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate |
|---|---|
| PubChem CID | 11372383 |
| Molecular Formula | C18H16F3N3OS |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | prop-2-enyl N'-benzyl-N-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate |
| SMILES | C=CCS/C(=N\Cc1ccccc1)NC(=O)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C18H16F3N3OS/c1-2-10-26-17(23-11-13-6-4-3-5-7-13)24-16(25)14-12-22-9-8-15(14)18(19,20)21/h2-9,12H,1,10-11H2,(H,23,24,25) |
| InChIKey | AFOOGOWYNLIPBL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|