C16H15F3N2O3S — CID 10406940
N-(2-benzylsulfonylethyl)-4-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 10406940) has the molecular formula C16H15F3N2O3S and a molecular weight of 372.37 g/mol. Its IUPAC name is N-(2-benzylsulfonylethyl)-4-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(2-benzylsulfonylethyl)-4-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10406940 |
| Molecular Formula | C16H15F3N2O3S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N-(2-benzylsulfonylethyl)-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)Cc1ccccc1)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C16H15F3N2O3S/c17-16(18,19)14-6-7-20-10-13(14)15(22)21-8-9-25(23,24)11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2,(H,21,22) |
| InChIKey | RARHYWHHLZYCHI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |