C15H18F3N3O — CID 139983760
N'-(1-prop-2-enylcyclopentyl)-4-(trifluoromethyl)pyridine-3-carbohydrazide (PubChem CID 139983760) has the molecular formula C15H18F3N3O and a molecular weight of 313.32 g/mol. Its IUPAC name is N'-(1-prop-2-enylcyclopentyl)-4-(trifluoromethyl)pyridine-3-carbohydrazide.
| Compound Name | N'-(1-prop-2-enylcyclopentyl)-4-(trifluoromethyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 139983760 |
| Molecular Formula | C15H18F3N3O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N'-(1-prop-2-enylcyclopentyl)-4-(trifluoromethyl)pyridine-3-carbohydrazide |
| SMILES | C=CCC1(NNC(=O)c2cnccc2C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C15H18F3N3O/c1-2-6-14(7-3-4-8-14)21-20-13(22)11-10-19-9-5-12(11)15(16,17)18/h2,5,9-10,21H,1,3-4,6-8H2,(H,20,22) |
| InChIKey | IYFCYDUCWOEQAK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|