C17H23ClN2O — CID 139242076
4-chloro-N'-(1-prop-2-enylcycloheptyl)benzohydrazide (PubChem CID 139242076) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is 4-chloro-N'-(1-prop-2-enylcycloheptyl)benzohydrazide.
| Compound Name | 4-chloro-N'-(1-prop-2-enylcycloheptyl)benzohydrazide |
|---|---|
| PubChem CID | 139242076 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 4-chloro-N'-(1-prop-2-enylcycloheptyl)benzohydrazide |
| SMILES | C=CCC1(NNC(=O)c2ccc(Cl)cc2)CCCCCC1 |
| InChI | InChI=1S/C17H23ClN2O/c1-2-11-17(12-5-3-4-6-13-17)20-19-16(21)14-7-9-15(18)10-8-14/h2,7-10,20H,1,3-6,11-13H2,(H,19,21) |
| InChIKey | MWKVPOMVZQKDNU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|