C14H17ClN2O — CID 139242073
4-chloro-N'-(1-prop-2-enylcyclobutyl)benzohydrazide (PubChem CID 139242073) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 4-chloro-N'-(1-prop-2-enylcyclobutyl)benzohydrazide.
| Compound Name | 4-chloro-N'-(1-prop-2-enylcyclobutyl)benzohydrazide |
|---|---|
| PubChem CID | 139242073 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-chloro-N'-(1-prop-2-enylcyclobutyl)benzohydrazide |
| SMILES | C=CCC1(NNC(=O)c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C14H17ClN2O/c1-2-8-14(9-3-10-14)17-16-13(18)11-4-6-12(15)7-5-11/h2,4-7,17H,1,3,8-10H2,(H,16,18) |
| InChIKey | UDMZLROXAUEHSH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|