C10H9N4P — CID 123748075
[1,2,4]triazolo[1,5-h][1,7]naphthyridin-2-ylmethylphosphane (PubChem CID 123748075) has the molecular formula C10H9N4P and a molecular weight of 216.18 g/mol. Its IUPAC name is [1,2,4]triazolo[1,5-h][1,7]naphthyridin-2-ylmethylphosphane.
| Compound Name | [1,2,4]triazolo[1,5-h][1,7]naphthyridin-2-ylmethylphosphane |
|---|---|
| PubChem CID | 123748075 |
| Molecular Formula | C10H9N4P |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | [1,2,4]triazolo[1,5-h][1,7]naphthyridin-2-ylmethylphosphane |
| SMILES | PCc1nc2c3ncccc3ccn2n1 |
| InChI | InChI=1S/C10H9N4P/c15-6-8-12-10-9-7(2-1-4-11-9)3-5-14(10)13-8/h1-5H,6,15H2 |
| InChIKey | SRFPKAZWKNLTHC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|