C17H27F — CID 123748122
11-fluoro-3,6-dimethyl-7-methylidenetetradeca-3,5,9-triene (PubChem CID 123748122) has the molecular formula C17H27F and a molecular weight of 250.40 g/mol. Its IUPAC name is 11-fluoro-3,6-dimethyl-7-methylidenetetradeca-3,5,9-triene.
| Compound Name | 11-fluoro-3,6-dimethyl-7-methylidenetetradeca-3,5,9-triene |
|---|---|
| PubChem CID | 123748122 |
| Molecular Formula | C17H27F |
| Molecular Weight | 250.40 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | 11-fluoro-3,6-dimethyl-7-methylidenetetradeca-3,5,9-triene |
| SMILES | C=C(CC=CC(F)CCC)C(C)=CC=C(C)CC |
| InChI | InChI=1S/C17H27F/c1-6-9-17(18)11-8-10-15(4)16(5)13-12-14(3)7-2/h8,11-13,17H,4,6-7,9-10H2,1-3,5H3 |
| InChIKey | GHLXOWFJOOLRLJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.40 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|