C37H59N5O5 — CID 123748603
1-[2-[(7-tert-butyl-1-bicyclo[4.2.0]octanyl)carbamoylamino]-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-4-propan-2-ylpyrrolidine-2-carboxamide (PubChem CID 123748603) has the molecular formula C37H59N5O5 and a molecular weight of 653.91 g/mol. Its IUPAC name is 1-[2-[(7-tert-butyl-1-bicyclo[4.2.0]octanyl)carbamoylamino]-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-4-propan-2-ylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[(7-tert-butyl-1-bicyclo[4.2.0]octanyl)carbamoylamino]-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-4-propan-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123748603 |
| Molecular Formula | C37H59N5O5 |
| Molecular Weight | 653.91 g/mol |
| Exact Mass | 653.45 |
| IUPAC Name | 1-[2-[(7-tert-butyl-1-bicyclo[4.2.0]octanyl)carbamoylamino]-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-4-propan-2-ylpyrrolidine-2-carboxamide |
| SMILES | C#CCCC(NC(=O)C1CC(C(C)C)CN1C(=O)C(NC(=O)NC12CCCCC1C(C(C)(C)C)C2)C(C)(C)C)C(=O)C(=O)NCC=C |
| InChI | InChI=1S/C37H59N5O5/c1-11-13-17-27(29(43)32(45)38-19-12-2)39-31(44)28-20-24(23(3)4)22-42(28)33(46)30(36(8,9)10)40-34(47)41-37-18-15-14-16-25(37)26(21-37)35(5,6)7/h1,12,23-28,30H,2,13-22H2,3-10H3,(H,38,45)(H,39,44)(H2,40,41,47) |
| InChIKey | AKGJZXNERSZFBG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.91 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|