C31H47N5O7 — CID 143354228
tert-butyl 2-[[(2S)-1-[(2S,4R)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]carbamoyl]-4-prop-2-enylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoylamino]acetate (PubChem CID 143354228) has the molecular formula C31H47N5O7 and a molecular weight of 601.75 g/mol. Its IUPAC name is tert-butyl 2-[[(2S)-1-[(2S,4R)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]carbamoyl]-4-prop-2-enylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoylamino]acetate.
| Compound Name | tert-butyl 2-[[(2S)-1-[(2S,4R)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]carbamoyl]-4-prop-2-enylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 143354228 |
| Molecular Formula | C31H47N5O7 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | tert-butyl 2-[[(2S)-1-[(2S,4R)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]carbamoyl]-4-prop-2-enylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoylamino]acetate |
| SMILES | C#CCCC(NC(=O)[C@@H]1C[C@@H](CC=C)CN1C(=O)[C@@H](NC(=O)NCC(=O)OC(C)(C)C)C(C)(C)C)C(=O)C(=O)NCC=C |
| InChI | InChI=1S/C31H47N5O7/c1-10-13-15-21(24(38)27(40)32-16-12-3)34-26(39)22-17-20(14-11-2)19-36(22)28(41)25(30(4,5)6)35-29(42)33-18-23(37)43-31(7,8)9/h1,11-12,20-22,25H,2-3,13-19H2,4-9H3,(H,32,40)(H,34,39)(H2,33,35,42)/t20-,21?,22+,25-/m1/s1 |
| InChIKey | MGPJGELHSCVUKY-AXZPQHBUSA-N |
| XLogP | 1.60 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|