C23H22FN3O4 — CID 123749456
6-[3-[4-(5-fluoro-2-methoxyphenyl)-2,3,6,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one (PubChem CID 123749456) has the molecular formula C23H22FN3O4 and a molecular weight of 423.44 g/mol. Its IUPAC name is 6-[3-[4-(5-fluoro-2-methoxyphenyl)-2,3,6,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one.
| Compound Name | 6-[3-[4-(5-fluoro-2-methoxyphenyl)-2,3,6,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 123749456 |
| Molecular Formula | C23H22FN3O4 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 6-[3-[4-(5-fluoro-2-methoxyphenyl)-2,3,6,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one |
| SMILES | COc1ccc(F)cc1C1=CCCN(C(=O)C=Cc2cnc3c(c2)COC(=O)N3)CC1 |
| InChI | InChI=1S/C23H22FN3O4/c1-30-20-6-5-18(24)12-19(20)16-3-2-9-27(10-8-16)21(28)7-4-15-11-17-14-31-23(29)26-22(17)25-13-15/h3-7,11-13H,2,8-10,14H2,1H3,(H,25,26,29) |
| InChIKey | OOGBYIZROALTFE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|