C26H29N3O — CID 90225411
(E)-1-[4-(2,5-dimethylphenyl)-2,3,6,7-tetrahydroazepin-1-yl]-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-en-1-one (PubChem CID 90225411) has the molecular formula C26H29N3O and a molecular weight of 399.54 g/mol. Its IUPAC name is (E)-1-[4-(2,5-dimethylphenyl)-2,3,6,7-tetrahydroazepin-1-yl]-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,5-dimethylphenyl)-2,3,6,7-tetrahydroazepin-1-yl]-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90225411 |
| Molecular Formula | C26H29N3O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | (E)-1-[4-(2,5-dimethylphenyl)-2,3,6,7-tetrahydroazepin-1-yl]-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-en-1-one |
| SMILES | C=C1CCc2cc(/C=C/C(=O)N3CCC=C(c4cc(C)ccc4C)CC3)cnc2N1 |
| InChI | InChI=1S/C26H29N3O/c1-18-6-7-19(2)24(15-18)22-5-4-13-29(14-12-22)25(30)11-9-21-16-23-10-8-20(3)28-26(23)27-17-21/h5-7,9,11,15-17H,3-4,8,10,12-14H2,1-2H3,(H,27,28)/b11-9+ |
| InChIKey | CZMLPYFLFBDMRE-PKNBQFBNSA-N |
| XLogP | 5.29 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|