C25H24F3N3O2 — CID 90225439
(E)-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)-1-[5-[2-(trifluoromethoxy)phenyl]-2,3,4,7-tetrahydroazepin-1-yl]prop-2-en-1-one (PubChem CID 90225439) has the molecular formula C25H24F3N3O2 and a molecular weight of 455.48 g/mol. Its IUPAC name is (E)-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)-1-[5-[2-(trifluoromethoxy)phenyl]-2,3,4,7-tetrahydroazepin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)-1-[5-[2-(trifluoromethoxy)phenyl]-2,3,4,7-tetrahydroazepin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 90225439 |
| Molecular Formula | C25H24F3N3O2 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (E)-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)-1-[5-[2-(trifluoromethoxy)phenyl]-2,3,4,7-tetrahydroazepin-1-yl]prop-2-en-1-one |
| SMILES | C=C1CCc2cc(/C=C/C(=O)N3CC=C(c4ccccc4OC(F)(F)F)CCC3)cnc2N1 |
| InChI | InChI=1S/C25H24F3N3O2/c1-17-8-10-20-15-18(16-29-24(20)30-17)9-11-23(32)31-13-4-5-19(12-14-31)21-6-2-3-7-22(21)33-25(26,27)28/h2-3,6-7,9,11-12,15-16H,1,4-5,8,10,13-14H2,(H,29,30)/b11-9+ |
| InChIKey | FNZYVCBWVGRUNN-PKNBQFBNSA-N |
| XLogP | 5.57 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|