C23H21Cl2N3O2 — CID 71262394
6-[(E)-3-[5-(2,3-dichlorophenyl)-2,3,4,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 71262394) has the molecular formula C23H21Cl2N3O2 and a molecular weight of 442.35 g/mol. Its IUPAC name is 6-[(E)-3-[5-(2,3-dichlorophenyl)-2,3,4,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[(E)-3-[5-(2,3-dichlorophenyl)-2,3,4,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 71262394 |
| Molecular Formula | C23H21Cl2N3O2 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 6-[(E)-3-[5-(2,3-dichlorophenyl)-2,3,4,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2cc(/C=C/C(=O)N3CC=C(c4cccc(Cl)c4Cl)CCC3)cnc2N1 |
| InChI | InChI=1S/C23H21Cl2N3O2/c24-19-5-1-4-18(22(19)25)16-3-2-11-28(12-10-16)21(30)9-6-15-13-17-7-8-20(29)27-23(17)26-14-15/h1,4-6,9-10,13-14H,2-3,7-8,11-12H2,(H,26,27,29)/b9-6+ |
| InChIKey | IZXABBJDJXKOGJ-RMKNXTFCSA-N |
| XLogP | 4.99 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|