C31H26N4O4 — CID 78127902
2-[[3-[1-[3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enoyl]-3,6-dihydro-2H-pyridin-4-yl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 78127902) has the molecular formula C31H26N4O4 and a molecular weight of 518.57 g/mol. Its IUPAC name is 2-[[3-[1-[3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enoyl]-3,6-dihydro-2H-pyridin-4-yl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[1-[3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enoyl]-3,6-dihydro-2H-pyridin-4-yl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 78127902 |
| Molecular Formula | C31H26N4O4 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 2-[[3-[1-[3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enoyl]-3,6-dihydro-2H-pyridin-4-yl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1CCc2cc(C=CC(=O)N3CC=C(c4cccc(CN5C(=O)c6ccccc6C5=O)c4)CC3)cnc2N1 |
| InChI | InChI=1S/C31H26N4O4/c36-27-10-9-24-16-20(18-32-29(24)33-27)8-11-28(37)34-14-12-22(13-15-34)23-5-3-4-21(17-23)19-35-30(38)25-6-1-2-7-26(25)31(35)39/h1-8,11-12,16-18H,9-10,13-15,19H2,(H,32,33,36) |
| InChIKey | OZHOCXVNZIRNEY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|