C25H27N3O2 — CID 90225400
(E)-1-[5-(3-methoxyphenyl)-2,3,4,7-tetrahydroazepin-1-yl]-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-en-1-one (PubChem CID 90225400) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is (E)-1-[5-(3-methoxyphenyl)-2,3,4,7-tetrahydroazepin-1-yl]-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[5-(3-methoxyphenyl)-2,3,4,7-tetrahydroazepin-1-yl]-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90225400 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (E)-1-[5-(3-methoxyphenyl)-2,3,4,7-tetrahydroazepin-1-yl]-3-(7-methylidene-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-en-1-one |
| SMILES | C=C1CCc2cc(/C=C/C(=O)N3CC=C(c4cccc(OC)c4)CCC3)cnc2N1 |
| InChI | InChI=1S/C25H27N3O2/c1-18-8-10-22-15-19(17-26-25(22)27-18)9-11-24(29)28-13-4-6-20(12-14-28)21-5-3-7-23(16-21)30-2/h3,5,7,9,11-12,15-17H,1,4,6,8,10,13-14H2,2H3,(H,26,27)/b11-9+ |
| InChIKey | IXAWALLOWNMHQZ-PKNBQFBNSA-N |
| XLogP | 4.68 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|