C34H54N2O2Si — CID 123750134
1-[12-[tert-butyl(diphenyl)silyl]oxydodec-5-enyl]-3-pentylurea (PubChem CID 123750134) has the molecular formula C34H54N2O2Si and a molecular weight of 550.90 g/mol. Its IUPAC name is 1-[12-[tert-butyl(diphenyl)silyl]oxydodec-5-enyl]-3-pentylurea.
| Compound Name | 1-[12-[tert-butyl(diphenyl)silyl]oxydodec-5-enyl]-3-pentylurea |
|---|---|
| PubChem CID | 123750134 |
| Molecular Formula | C34H54N2O2Si |
| Molecular Weight | 550.90 g/mol |
| Exact Mass | 550.40 |
| IUPAC Name | 1-[12-[tert-butyl(diphenyl)silyl]oxydodec-5-enyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)NCCCCC=CCCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H54N2O2Si/c1-5-6-21-28-35-33(37)36-29-22-13-11-9-7-8-10-12-14-23-30-38-39(34(2,3)4,31-24-17-15-18-25-31)32-26-19-16-20-27-32/h7,9,15-20,24-27H,5-6,8,10-14,21-23,28-30H2,1-4H3,(H2,35,36,37) |
| InChIKey | ZBVMYJUYHNFXFP-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.90 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|