C31H52N2O3Si2 — CID 59032210
1,3-bis[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]urea (PubChem CID 59032210) has the molecular formula C31H52N2O3Si2 and a molecular weight of 556.94 g/mol. Its IUPAC name is 1,3-bis[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]urea.
| Compound Name | 1,3-bis[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]urea |
|---|---|
| PubChem CID | 59032210 |
| Molecular Formula | C31H52N2O3Si2 |
| Molecular Weight | 556.94 g/mol |
| Exact Mass | 556.35 |
| IUPAC Name | 1,3-bis[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]urea |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](Cc1ccccc1)NC(=O)N[C@@H](CO[Si](C)(C)C(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C31H52N2O3Si2/c1-30(2,3)37(7,8)35-23-27(21-25-17-13-11-14-18-25)32-29(34)33-28(22-26-19-15-12-16-20-26)24-36-38(9,10)31(4,5)6/h11-20,27-28H,21-24H2,1-10H3,(H2,32,33,34)/t27-,28-/m1/s1 |
| InChIKey | BKIPPIHSOCQJBT-VSGBNLITSA-N |
| XLogP | 7.55 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.94 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|