C20H13Cl2F3N4SSi — CID 123750180
CID 123750180 (PubChem CID 123750180) has the molecular formula C20H13Cl2F3N4SSi and a molecular weight of 497.41 g/mol.
| Compound Name | CID 123750180 |
|---|---|
| PubChem CID | 123750180 |
| Molecular Formula | C20H13Cl2F3N4SSi |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 496.00 |
| IUPAC Name | — |
| SMILES | C[Si]c1nc(Nc2ccc(C(F)(F)F)cc2)c2nc(Cc3c(Cl)cccc3Cl)sc2n1 |
| InChI | InChI=1S/C20H13Cl2F3N4SSi/c1-31-19-28-17(26-11-7-5-10(6-8-11)20(23,24)25)16-18(29-19)30-15(27-16)9-12-13(21)3-2-4-14(12)22/h2-8H,9H2,1H3,(H,26,28,29) |
| InChIKey | DHKKGACUJHGJFC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|