C12H18N3O+ — CID 123750973
6-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]hexa-1,5-dien-3-imine (PubChem CID 123750973) has the molecular formula C12H18N3O+ and a molecular weight of 220.30 g/mol. Its IUPAC name is 6-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]hexa-1,5-dien-3-imine.
| Compound Name | 6-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]hexa-1,5-dien-3-imine |
|---|---|
| PubChem CID | 123750973 |
| Molecular Formula | C12H18N3O+ |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 6-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]hexa-1,5-dien-3-imine |
| SMILES | [H]/N=C(\C=C)CC=COCCn1cc[n+](C)c1 |
| InChI | InChI=1S/C12H18N3O/c1-3-12(13)5-4-9-16-10-8-15-7-6-14(2)11-15/h3-4,6-7,9,11,13H,1,5,8,10H2,2H3/q+1/b9-4?,13-12+ |
| InChIKey | IBHUIKFSLQWLRE-XKMXXPKNSA-N |
| XLogP | 1.44 |
| TPSA | 41.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|