C9H16N4 — CID 123751085
N-but-2-en-2-yl-N'-[(2Z)-2-(ethylidenehydrazinylidene)ethyl]methanimidamide (PubChem CID 123751085) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N-but-2-en-2-yl-N'-[(2Z)-2-(ethylidenehydrazinylidene)ethyl]methanimidamide.
| Compound Name | N-but-2-en-2-yl-N'-[(2Z)-2-(ethylidenehydrazinylidene)ethyl]methanimidamide |
|---|---|
| PubChem CID | 123751085 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N-but-2-en-2-yl-N'-[(2Z)-2-(ethylidenehydrazinylidene)ethyl]methanimidamide |
| SMILES | CC=N/N=C\C/N=C/NC(C)=CC |
| InChI | InChI=1S/C9H16N4/c1-4-9(3)11-8-10-6-7-13-12-5-2/h4-5,7-8H,6H2,1-3H3,(H,10,11)/b9-4?,12-5?,13-7- |
| InChIKey | LOTLPDRWUVEHSS-ZWUSZFPNSA-N |
| XLogP | 1.60 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|