C34H37ClN4O2 — CID 123751981
2-[2-[[[3-(chloromethyl)phenyl]-hydroxymethyl]amino]-5-(diethylamino)phenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-4-carboxamide (PubChem CID 123751981) has the molecular formula C34H37ClN4O2 and a molecular weight of 569.15 g/mol. Its IUPAC name is 2-[2-[[[3-(chloromethyl)phenyl]-hydroxymethyl]amino]-5-(diethylamino)phenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-4-carboxamide.
| Compound Name | 2-[2-[[[3-(chloromethyl)phenyl]-hydroxymethyl]amino]-5-(diethylamino)phenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 123751981 |
| Molecular Formula | C34H37ClN4O2 |
| Molecular Weight | 569.15 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | 2-[2-[[[3-(chloromethyl)phenyl]-hydroxymethyl]amino]-5-(diethylamino)phenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(O)c2cccc(CCl)c2)c(-c2cc(C(=O)NC3CCCc4ccccc43)ccn2)c1 |
| InChI | InChI=1S/C34H37ClN4O2/c1-3-39(4-2)27-15-16-31(38-33(40)25-12-7-9-23(19-25)22-35)29(21-27)32-20-26(17-18-36-32)34(41)37-30-14-8-11-24-10-5-6-13-28(24)30/h5-7,9-10,12-13,15-21,30,33,38,40H,3-4,8,11,14,22H2,1-2H3,(H,37,41) |
| InChIKey | PAUQTNZOVDUWLA-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.15 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|