C17H22N4S2 — CID 123752323
2-[methyl-[[1-(5-sulfanyl-2-pyridinyl)piperidin-3-yl]methyl]amino]pyridine-3-thiol (PubChem CID 123752323) has the molecular formula C17H22N4S2 and a molecular weight of 346.53 g/mol. Its IUPAC name is 2-[methyl-[[1-(5-sulfanyl-2-pyridinyl)piperidin-3-yl]methyl]amino]pyridine-3-thiol.
| Compound Name | 2-[methyl-[[1-(5-sulfanyl-2-pyridinyl)piperidin-3-yl]methyl]amino]pyridine-3-thiol |
|---|---|
| PubChem CID | 123752323 |
| Molecular Formula | C17H22N4S2 |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[methyl-[[1-(5-sulfanyl-2-pyridinyl)piperidin-3-yl]methyl]amino]pyridine-3-thiol |
| SMILES | CN(CC1CCCN(c2ccc(S)cn2)C1)c1ncccc1S |
| InChI | InChI=1S/C17H22N4S2/c1-20(17-15(23)5-2-8-18-17)11-13-4-3-9-21(12-13)16-7-6-14(22)10-19-16/h2,5-8,10,13,22-23H,3-4,9,11-12H2,1H3 |
| InChIKey | UFGCOADQDQMOAC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|