C30H42Br2O10 — CID 123752712
1,2-bis[4-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]phenyl]-2-hydroxyethanone (PubChem CID 123752712) has the molecular formula C30H42Br2O10 and a molecular weight of 722.46 g/mol. Its IUPAC name is 1,2-bis[4-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]phenyl]-2-hydroxyethanone.
| Compound Name | 1,2-bis[4-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]phenyl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 123752712 |
| Molecular Formula | C30H42Br2O10 |
| Molecular Weight | 722.46 g/mol |
| Exact Mass | 720.11 |
| IUPAC Name | 1,2-bis[4-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]phenyl]-2-hydroxyethanone |
| SMILES | O=C(c1ccc(OCCOCCOCCOCCBr)cc1)C(O)c1ccc(OCCOCCOCCOCCBr)cc1 |
| InChI | InChI=1S/C30H42Br2O10/c31-9-11-35-13-15-37-17-19-39-21-23-41-27-5-1-25(2-6-27)29(33)30(34)26-3-7-28(8-4-26)42-24-22-40-20-18-38-16-14-36-12-10-32/h1-8,29,33H,9-24H2 |
| InChIKey | IOABBKFISHNLNY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|