C18H26ClN3O4 — CID 123753179
tert-butyl N-[(2S)-1-amino-6-chloro-1-oxo-5-phenylmethoxyiminohexan-2-yl]carbamate (PubChem CID 123753179) has the molecular formula C18H26ClN3O4 and a molecular weight of 383.88 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-amino-6-chloro-1-oxo-5-phenylmethoxyiminohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-amino-6-chloro-1-oxo-5-phenylmethoxyiminohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 123753179 |
| Molecular Formula | C18H26ClN3O4 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | tert-butyl N-[(2S)-1-amino-6-chloro-1-oxo-5-phenylmethoxyiminohexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(CCl)=NOCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C18H26ClN3O4/c1-18(2,3)26-17(24)21-15(16(20)23)10-9-14(11-19)22-25-12-13-7-5-4-6-8-13/h4-8,15H,9-12H2,1-3H3,(H2,20,23)(H,21,24)/t15-/m0/s1 |
| InChIKey | JCZLONUXXCOCCM-HNNXBMFYSA-N |
| XLogP | 2.96 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|