C20H32BrN5O3Si — CID 123753260
tert-butyl 2-[5-[bromo(2-trimethylsilylethoxy)methyl]-3H-imidazo[4,5-b]pyrazin-2-yl]pyrrolidine-1-carboxylate (PubChem CID 123753260) has the molecular formula C20H32BrN5O3Si and a molecular weight of 498.50 g/mol. Its IUPAC name is tert-butyl 2-[5-[bromo(2-trimethylsilylethoxy)methyl]-3H-imidazo[4,5-b]pyrazin-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[5-[bromo(2-trimethylsilylethoxy)methyl]-3H-imidazo[4,5-b]pyrazin-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123753260 |
| Molecular Formula | C20H32BrN5O3Si |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | tert-butyl 2-[5-[bromo(2-trimethylsilylethoxy)methyl]-3H-imidazo[4,5-b]pyrazin-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1nc2ncc(C(Br)OCC[Si](C)(C)C)nc2[nH]1 |
| InChI | InChI=1S/C20H32BrN5O3Si/c1-20(2,3)29-19(27)26-9-7-8-14(26)16-24-17-18(25-16)23-13(12-22-17)15(21)28-10-11-30(4,5)6/h12,14-15H,7-11H2,1-6H3,(H,22,23,24,25) |
| InChIKey | WPTLDVBTHBPQPV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|