C13H12 — CID 123755544
11-methyldodeca-1,11-dien-3,5,7-triyne (PubChem CID 123755544) has the molecular formula C13H12 and a molecular weight of 168.24 g/mol. Its IUPAC name is 11-methyldodeca-1,11-dien-3,5,7-triyne.
| Compound Name | 11-methyldodeca-1,11-dien-3,5,7-triyne |
|---|---|
| PubChem CID | 123755544 |
| Molecular Formula | C13H12 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 11-methyldodeca-1,11-dien-3,5,7-triyne |
| SMILES | C=CC#CC#CC#CCCC(=C)C |
| InChI | InChI=1S/C13H12/c1-4-5-6-7-8-9-10-11-12-13(2)3/h4H,1-2,11-12H2,3H3 |
| InChIKey | ITBCOLILTPLGSC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|