C26H49FN8O2 — CID 123755717
3,3-diamino-2-(5-butyl-1-ethyl-5-fluoro-3-methyl-1,3-diazinan-2-yl)-N-[4-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide (PubChem CID 123755717) has the molecular formula C26H49FN8O2 and a molecular weight of 524.73 g/mol. Its IUPAC name is 3,3-diamino-2-(5-butyl-1-ethyl-5-fluoro-3-methyl-1,3-diazinan-2-yl)-N-[4-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(5-butyl-1-ethyl-5-fluoro-3-methyl-1,3-diazinan-2-yl)-N-[4-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123755717 |
| Molecular Formula | C26H49FN8O2 |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.40 |
| IUPAC Name | 3,3-diamino-2-(5-butyl-1-ethyl-5-fluoro-3-methyl-1,3-diazinan-2-yl)-N-[4-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
| SMILES | CCCCC1(F)CN(C)C(C(C(=O)NC2CNCCC2N2CC(=O)N3CCCC3C2)C(N)N)N(CC)C1 |
| InChI | InChI=1S/C26H49FN8O2/c1-4-6-10-26(27)16-32(3)25(33(5-2)17-26)22(23(28)29)24(37)31-19-13-30-11-9-20(19)34-14-18-8-7-12-35(18)21(36)15-34/h18-20,22-23,25,30H,4-17,28-29H2,1-3H3,(H,31,37) |
| InChIKey | BAZHNFJGJUNQCM-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|