About 2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane]
2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane] (PubChem CID 123756901) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is 2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane].
Molecular Properties
| Compound Name | 2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane] |
| PubChem CID | 123756901 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane] |
| SMILES | CCCCCC1CC12C1CCC2C1 |
| InChI | InChI=1S/C13H22/c1-2-3-4-5-12-9-13(12)10-6-7-11(13)8-10/h10-12H,2-9H2,1H3 |
| InChIKey | YHMSHAOJAGJRRD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane]?
The IUPAC name of 2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane] (CID 123756901) is 2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane].
What is the SMILES notation for 2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane]?
The canonical SMILES for 2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane] is CCCCCC1CC12C1CCC2C1.
What is the InChIKey of 2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane]?
The InChIKey is YHMSHAOJAGJRRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22/c1-2-3-4-5-12-9-13(12)10-6-7-11(13)8-10/h10-12H,2-9H2,1H3.
What are the key properties of 2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane]?
2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane] has a molecular weight of 178.32 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-pentylspiro[bicyclo[2.1.1]hexane-5,1'-cyclopropane] is sourced from PubChem (CID 123756901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).