C21H35N5O2 — CID 123756987
2-(2,4-diethyl-5,12-dioxa-9,16,17,20-tetrazatricyclo[11.5.2.016,19]icosa-1(19),13(20),14,17-tetraen-9-yl)-N-methylethanamine (PubChem CID 123756987) has the molecular formula C21H35N5O2 and a molecular weight of 389.54 g/mol. Its IUPAC name is 2-(2,4-diethyl-5,12-dioxa-9,16,17,20-tetrazatricyclo[11.5.2.016,19]icosa-1(19),13(20),14,17-tetraen-9-yl)-N-methylethanamine.
| Compound Name | 2-(2,4-diethyl-5,12-dioxa-9,16,17,20-tetrazatricyclo[11.5.2.016,19]icosa-1(19),13(20),14,17-tetraen-9-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 123756987 |
| Molecular Formula | C21H35N5O2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | 2-(2,4-diethyl-5,12-dioxa-9,16,17,20-tetrazatricyclo[11.5.2.016,19]icosa-1(19),13(20),14,17-tetraen-9-yl)-N-methylethanamine |
| SMILES | CCC1CC(CC)c2cnn3ccc(nc23)OCCN(CCNC)CCCO1 |
| InChI | InChI=1S/C21H35N5O2/c1-4-17-15-18(5-2)27-13-6-9-25(11-8-22-3)12-14-28-20-7-10-26-21(24-20)19(17)16-23-26/h7,10,16-18,22H,4-6,8-9,11-15H2,1-3H3 |
| InChIKey | WTWOBPCCHMDMSZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |