C20H31N5O2 — CID 123984215
2-(8,14-dioxa-11,18,19,22-tetrazatetracyclo[13.5.2.12,7.018,21]tricosa-1(21),15(22),16,19-tetraen-11-yl)-N-methylethanamine (PubChem CID 123984215) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-(8,14-dioxa-11,18,19,22-tetrazatetracyclo[13.5.2.12,7.018,21]tricosa-1(21),15(22),16,19-tetraen-11-yl)-N-methylethanamine.
| Compound Name | 2-(8,14-dioxa-11,18,19,22-tetrazatetracyclo[13.5.2.12,7.018,21]tricosa-1(21),15(22),16,19-tetraen-11-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 123984215 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 2-(8,14-dioxa-11,18,19,22-tetrazatetracyclo[13.5.2.12,7.018,21]tricosa-1(21),15(22),16,19-tetraen-11-yl)-N-methylethanamine |
| SMILES | CNCCN1CCOc2ccn3ncc(c3n2)C2CCCCC(C2)OCC1 |
| InChI | InChI=1S/C20H31N5O2/c1-21-7-9-24-10-12-26-17-5-3-2-4-16(14-17)18-15-22-25-8-6-19(23-20(18)25)27-13-11-24/h6,8,15-17,21H,2-5,7,9-14H2,1H3 |
| InChIKey | DMZXWZXBAOPQEO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |