C11H19N5O — CID 123757004
N-(azepan-4-yl)-3-(methylamino)-1H-pyrazole-5-carboxamide (PubChem CID 123757004) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is N-(azepan-4-yl)-3-(methylamino)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(azepan-4-yl)-3-(methylamino)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 123757004 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | N-(azepan-4-yl)-3-(methylamino)-1H-pyrazole-5-carboxamide |
| SMILES | CNc1cc(C(=O)NC2CCCNCC2)[nH]n1 |
| InChI | InChI=1S/C11H19N5O/c1-12-10-7-9(15-16-10)11(17)14-8-3-2-5-13-6-4-8/h7-8,13H,2-6H2,1H3,(H,14,17)(H2,12,15,16) |
| InChIKey | MWDZMDJDOUZIDI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |