C29H28F3N5O2 — CID 123757050
butyl 2-phenyl-3-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]quinoxaline-6-carboxylate (PubChem CID 123757050) has the molecular formula C29H28F3N5O2 and a molecular weight of 535.57 g/mol. Its IUPAC name is butyl 2-phenyl-3-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]quinoxaline-6-carboxylate.
| Compound Name | butyl 2-phenyl-3-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 123757050 |
| Molecular Formula | C29H28F3N5O2 |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | butyl 2-phenyl-3-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]quinoxaline-6-carboxylate |
| SMILES | CCCCOC(=O)c1ccc2nc(-c3ccccc3)c(N3CCN(c4ccc(C(F)(F)F)cn4)CC3)nc2c1 |
| InChI | InChI=1S/C29H28F3N5O2/c1-2-3-17-39-28(38)21-9-11-23-24(18-21)35-27(26(34-23)20-7-5-4-6-8-20)37-15-13-36(14-16-37)25-12-10-22(19-33-25)29(30,31)32/h4-12,18-19H,2-3,13-17H2,1H3 |
| InChIKey | CHZOBKSZZVJEFR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|