C15H15NO5S — CID 123758689
2-[4-(dimethylamino)-2-hydroxybenzoyl]benzenesulfonic acid (PubChem CID 123758689) has the molecular formula C15H15NO5S and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-2-hydroxybenzoyl]benzenesulfonic acid.
| Compound Name | 2-[4-(dimethylamino)-2-hydroxybenzoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 123758689 |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-[4-(dimethylamino)-2-hydroxybenzoyl]benzenesulfonic acid |
| SMILES | CN(C)c1ccc(C(=O)c2ccccc2S(=O)(=O)O)c(O)c1 |
| InChI | InChI=1S/C15H15NO5S/c1-16(2)10-7-8-11(13(17)9-10)15(18)12-5-3-4-6-14(12)22(19,20)21/h3-9,17H,1-2H3,(H,19,20,21) |
| InChIKey | YHIUWRSPUTYGFY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|