C33H36F2N2O2 — CID 123758839
1-[1-benzyl-6-[(Z)-C-methyl-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl]-2-propan-2-ylindol-3-yl]-3-(3,4-difluorophenyl)propan-1-one (PubChem CID 123758839) has the molecular formula C33H36F2N2O2 and a molecular weight of 530.66 g/mol. Its IUPAC name is 1-[1-benzyl-6-[(Z)-C-methyl-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl]-2-propan-2-ylindol-3-yl]-3-(3,4-difluorophenyl)propan-1-one.
| Compound Name | 1-[1-benzyl-6-[(Z)-C-methyl-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl]-2-propan-2-ylindol-3-yl]-3-(3,4-difluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 123758839 |
| Molecular Formula | C33H36F2N2O2 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 1-[1-benzyl-6-[(Z)-C-methyl-N-[(2-methylpropan-2-yl)oxy]carbonimidoyl]-2-propan-2-ylindol-3-yl]-3-(3,4-difluorophenyl)propan-1-one |
| SMILES | C/C(=N/OC(C)(C)C)c1ccc2c(C(=O)CCc3ccc(F)c(F)c3)c(C(C)C)n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C33H36F2N2O2/c1-21(2)32-31(30(38)17-13-23-12-16-27(34)28(35)18-23)26-15-14-25(22(3)36-39-33(4,5)6)19-29(26)37(32)20-24-10-8-7-9-11-24/h7-12,14-16,18-19,21H,13,17,20H2,1-6H3/b36-22- |
| InChIKey | AJVABFZMLLJSGW-ICUTVXMZSA-N |
| XLogP | 8.45 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|