C27H25F2N3O2 — CID 72555271
1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-(hydroxyiminomethyl)-2-propan-2-ylindole-3-carboxamide (PubChem CID 72555271) has the molecular formula C27H25F2N3O2 and a molecular weight of 461.51 g/mol. Its IUPAC name is 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-(hydroxyiminomethyl)-2-propan-2-ylindole-3-carboxamide.
| Compound Name | 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-(hydroxyiminomethyl)-2-propan-2-ylindole-3-carboxamide |
|---|---|
| PubChem CID | 72555271 |
| Molecular Formula | C27H25F2N3O2 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-(hydroxyiminomethyl)-2-propan-2-ylindole-3-carboxamide |
| SMILES | CC(C)c1c(C(=O)NCc2ccc(F)c(F)c2)c2ccc(C=NO)cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C27H25F2N3O2/c1-17(2)26-25(27(33)30-14-19-9-11-22(28)23(29)12-19)21-10-8-20(15-31-34)13-24(21)32(26)16-18-6-4-3-5-7-18/h3-13,15,17,34H,14,16H2,1-2H3,(H,30,33) |
| InChIKey | TXRWSOWGENSLCQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|