C32H36F2N2O2 — CID 25059747
1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hexoxy-2-propan-2-ylindole-3-carboxamide (PubChem CID 25059747) has the molecular formula C32H36F2N2O2 and a molecular weight of 518.65 g/mol. Its IUPAC name is 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hexoxy-2-propan-2-ylindole-3-carboxamide.
| Compound Name | 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hexoxy-2-propan-2-ylindole-3-carboxamide |
|---|---|
| PubChem CID | 25059747 |
| Molecular Formula | C32H36F2N2O2 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hexoxy-2-propan-2-ylindole-3-carboxamide |
| SMILES | CCCCCCOc1ccc2c(C(=O)NCc3ccc(F)c(F)c3)c(C(C)C)n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C32H36F2N2O2/c1-4-5-6-10-17-38-25-14-15-26-29(19-25)36(21-23-11-8-7-9-12-23)31(22(2)3)30(26)32(37)35-20-24-13-16-27(33)28(34)18-24/h7-9,11-16,18-19,22H,4-6,10,17,20-21H2,1-3H3,(H,35,37) |
| InChIKey | LGZFQQBSHRVYOY-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|