C27H24F5N3O4S — CID 59762377
[3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-yl-1-(1-pyridin-2-ylethyl)indol-6-yl] trifluoromethanesulfonate (PubChem CID 59762377) has the molecular formula C27H24F5N3O4S and a molecular weight of 581.56 g/mol. Its IUPAC name is [3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-yl-1-(1-pyridin-2-ylethyl)indol-6-yl] trifluoromethanesulfonate.
| Compound Name | [3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-yl-1-(1-pyridin-2-ylethyl)indol-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59762377 |
| Molecular Formula | C27H24F5N3O4S |
| Molecular Weight | 581.56 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | [3-[(3,4-difluorophenyl)methylcarbamoyl]-2-propan-2-yl-1-(1-pyridin-2-ylethyl)indol-6-yl] trifluoromethanesulfonate |
| SMILES | CC(C)c1c(C(=O)NCc2ccc(F)c(F)c2)c2ccc(OS(=O)(=O)C(F)(F)F)cc2n1C(C)c1ccccn1 |
| InChI | InChI=1S/C27H24F5N3O4S/c1-15(2)25-24(26(36)34-14-17-7-10-20(28)21(29)12-17)19-9-8-18(39-40(37,38)27(30,31)32)13-23(19)35(25)16(3)22-6-4-5-11-33-22/h4-13,15-16H,14H2,1-3H3,(H,34,36) |
| InChIKey | QIOFLKKZTFCSLE-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|