C27H26F2N4O2 — CID 74959745
N-[(3,4-difluorophenyl)methyl]-6-(methoxyiminomethyl)-2-propan-2-yl-1-(pyridin-2-ylmethyl)indole-3-carboxamide (PubChem CID 74959745) has the molecular formula C27H26F2N4O2 and a molecular weight of 476.53 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-6-(methoxyiminomethyl)-2-propan-2-yl-1-(pyridin-2-ylmethyl)indole-3-carboxamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-6-(methoxyiminomethyl)-2-propan-2-yl-1-(pyridin-2-ylmethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 74959745 |
| Molecular Formula | C27H26F2N4O2 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-6-(methoxyiminomethyl)-2-propan-2-yl-1-(pyridin-2-ylmethyl)indole-3-carboxamide |
| SMILES | CON=Cc1ccc2c(C(=O)NCc3ccc(F)c(F)c3)c(C(C)C)n(Cc3ccccn3)c2c1 |
| InChI | InChI=1S/C27H26F2N4O2/c1-17(2)26-25(27(34)31-14-18-8-10-22(28)23(29)12-18)21-9-7-19(15-32-35-3)13-24(21)33(26)16-20-6-4-5-11-30-20/h4-13,15,17H,14,16H2,1-3H3,(H,31,34) |
| InChIKey | NGISWOXSQXABKS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|