C33H39FN2O2 — CID 91099234
1-benzyl-N-[(3-fluoro-4-methylphenyl)methyl]-6-hexoxy-2-propan-2-ylindole-3-carboxamide (PubChem CID 91099234) has the molecular formula C33H39FN2O2 and a molecular weight of 514.69 g/mol. Its IUPAC name is 1-benzyl-N-[(3-fluoro-4-methylphenyl)methyl]-6-hexoxy-2-propan-2-ylindole-3-carboxamide.
| Compound Name | 1-benzyl-N-[(3-fluoro-4-methylphenyl)methyl]-6-hexoxy-2-propan-2-ylindole-3-carboxamide |
|---|---|
| PubChem CID | 91099234 |
| Molecular Formula | C33H39FN2O2 |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | 1-benzyl-N-[(3-fluoro-4-methylphenyl)methyl]-6-hexoxy-2-propan-2-ylindole-3-carboxamide |
| SMILES | CCCCCCOc1ccc2c(C(=O)NCc3ccc(C)c(F)c3)c(C(C)C)n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C33H39FN2O2/c1-5-6-7-11-18-38-27-16-17-28-30(20-27)36(22-25-12-9-8-10-13-25)32(23(2)3)31(28)33(37)35-21-26-15-14-24(4)29(34)19-26/h8-10,12-17,19-20,23H,5-7,11,18,21-22H2,1-4H3,(H,35,37) |
| InChIKey | PCDCSGUYRBCIGJ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|