About 1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide
1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide (PubChem CID 58248489) has the molecular formula C22H21F2N3O2
and a molecular weight of 397.43 g/mol. Its IUPAC name is 1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide |
| PubChem CID | 58248489 |
| Molecular Formula | C22H21F2N3O2 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide |
| SMILES | CC(C)c1c(C(=O)NCc2ccc(F)c(F)c2)nc(C=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C22H21F2N3O2/c1-14(2)21-20(22(29)25-11-16-8-9-17(23)18(24)10-16)26-19(13-28)27(21)12-15-6-4-3-5-7-15/h3-10,13-14H,11-12H2,1-2H3,(H,25,29) |
| InChIKey | IOUXVCNIBCHTOA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide?
The IUPAC name of 1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide (CID 58248489) is 1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide.
What is the SMILES notation for 1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide?
The canonical SMILES for 1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide is CC(C)c1c(C(=O)NCc2ccc(F)c(F)c2)nc(C=O)n1Cc1ccccc1.
What is the InChIKey of 1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide?
The InChIKey is IOUXVCNIBCHTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F2N3O2/c1-14(2)21-20(22(29)25-11-16-8-9-17(23)18(24)10-16)26-19(13-28)27(21)12-15-6-4-3-5-7-15/h3-10,13-14H,11-12H2,1-2H3,(H,25,29).
What are the key properties of 1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide?
1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide has a molecular weight of 397.43 g/mol, XLogP of 4.08, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-N-[(3,4-difluorophenyl)methyl]-2-formyl-5-propan-2-ylimidazole-4-carboxamide is sourced from PubChem (CID 58248489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).