C31H35F2N3O2 — CID 143832292
1-benzyl-3-formyl-N,2-di(propan-2-yl)indole-6-carboxamide;1-(3,4-difluorophenyl)-N-methylmethanamine (PubChem CID 143832292) has the molecular formula C31H35F2N3O2 and a molecular weight of 519.64 g/mol. Its IUPAC name is 1-benzyl-3-formyl-N,2-di(propan-2-yl)indole-6-carboxamide;1-(3,4-difluorophenyl)-N-methylmethanamine.
| Compound Name | 1-benzyl-3-formyl-N,2-di(propan-2-yl)indole-6-carboxamide;1-(3,4-difluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 143832292 |
| Molecular Formula | C31H35F2N3O2 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | 1-benzyl-3-formyl-N,2-di(propan-2-yl)indole-6-carboxamide;1-(3,4-difluorophenyl)-N-methylmethanamine |
| SMILES | CC(C)NC(=O)c1ccc2c(C=O)c(C(C)C)n(Cc3ccccc3)c2c1.CNCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H26N2O2.C8H9F2N/c1-15(2)22-20(14-26)19-11-10-18(23(27)24-16(3)4)12-21(19)25(22)13-17-8-6-5-7-9-17;1-11-5-6-2-3-7(9)8(10)4-6/h5-12,14-16H,13H2,1-4H3,(H,24,27);2-4,11H,5H2,1H3 |
| InChIKey | OPKPUMMUMGLDIM-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|