C12H20FNO3 — CID 123759539
4-fluoro-4-methyl-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]pyrrolidine-2-carboxylic acid (PubChem CID 123759539) has the molecular formula C12H20FNO3 and a molecular weight of 245.29 g/mol. Its IUPAC name is 4-fluoro-4-methyl-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 4-fluoro-4-methyl-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 123759539 |
| Molecular Formula | C12H20FNO3 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4-fluoro-4-methyl-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]pyrrolidine-2-carboxylic acid |
| SMILES | C=C(OC(C)(C)C)N1CC(C)(F)CC1C(=O)O |
| InChI | InChI=1S/C12H20FNO3/c1-8(17-11(2,3)4)14-7-12(5,13)6-9(14)10(15)16/h9H,1,6-7H2,2-5H3,(H,15,16) |
| InChIKey | QRXPKMOQRJEEEN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|