About 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine
2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine (PubChem CID 123759581) has the molecular formula C16H14N4S
and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine |
| PubChem CID | 123759581 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine |
| SMILES | [C-]#[N+]c1cnc2c(c1)nc(-c1ccccc1SCC)n2C |
| InChI | InChI=1S/C16H14N4S/c1-4-21-14-8-6-5-7-12(14)15-19-13-9-11(17-2)10-18-16(13)20(15)3/h5-10H,4H2,1,3H3 |
| InChIKey | PGBQWFFAPSZYRX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine?
The IUPAC name of 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine (CID 123759581) is 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine.
What is the SMILES notation for 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine?
The canonical SMILES for 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine is [C-]#[N+]c1cnc2c(c1)nc(-c1ccccc1SCC)n2C.
What is the InChIKey of 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine?
The InChIKey is PGBQWFFAPSZYRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4S/c1-4-21-14-8-6-5-7-12(14)15-19-13-9-11(17-2)10-18-16(13)20(15)3/h5-10H,4H2,1,3H3.
What are the key properties of 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine?
2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine has a molecular weight of 294.38 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine is sourced from PubChem (CID 123759581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).