C16H14N4S — CID 123759581
2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine (PubChem CID 123759581) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine.
| Compound Name | 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 123759581 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-(2-ethylsulfanylphenyl)-6-isocyano-3-methylimidazo[4,5-b]pyridine |
| SMILES | [C-]#[N+]c1cnc2c(c1)nc(-c1ccccc1SCC)n2C |
| InChI | InChI=1S/C16H14N4S/c1-4-21-14-8-6-5-7-12(14)15-19-13-9-11(17-2)10-18-16(13)20(15)3/h5-10H,4H2,1,3H3 |
| InChIKey | PGBQWFFAPSZYRX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|