About 2-ethylsulfanylethenyl-methyl-methylideneazanium
2-ethylsulfanylethenyl-methyl-methylideneazanium (PubChem CID 123759652) has the molecular formula C6H12NS+
and a molecular weight of 130.24 g/mol. Its IUPAC name is 2-ethylsulfanylethenyl-methyl-methylideneazanium.
Molecular Properties
| Compound Name | 2-ethylsulfanylethenyl-methyl-methylideneazanium |
| PubChem CID | 123759652 |
| Molecular Formula | C6H12NS+ |
| Molecular Weight | 130.24 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 2-ethylsulfanylethenyl-methyl-methylideneazanium |
| SMILES | C=[N+](C)C=CSCC |
| InChI | InChI=1S/C6H12NS/c1-4-8-6-5-7(2)3/h5-6H,2,4H2,1,3H3/q+1 |
| InChIKey | YTZNQJQYYDOWQI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylsulfanylethenyl-methyl-methylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanylethenyl-methyl-methylideneazanium?
The IUPAC name of 2-ethylsulfanylethenyl-methyl-methylideneazanium (CID 123759652) is 2-ethylsulfanylethenyl-methyl-methylideneazanium.
What is the SMILES notation for 2-ethylsulfanylethenyl-methyl-methylideneazanium?
The canonical SMILES for 2-ethylsulfanylethenyl-methyl-methylideneazanium is C=[N+](C)C=CSCC.
What is the InChIKey of 2-ethylsulfanylethenyl-methyl-methylideneazanium?
The InChIKey is YTZNQJQYYDOWQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12NS/c1-4-8-6-5-7(2)3/h5-6H,2,4H2,1,3H3/q+1.
What are the key properties of 2-ethylsulfanylethenyl-methyl-methylideneazanium?
2-ethylsulfanylethenyl-methyl-methylideneazanium has a molecular weight of 130.24 g/mol, XLogP of 1.55, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanylethenyl-methyl-methylideneazanium is sourced from PubChem (CID 123759652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).