C13H14BrNO2 — CID 123759738
(5R,6aR)-3-bromo-5-phenylmethoxy-4,5,6,6a-tetrahydro-2H-cyclopenta[d][1,2]oxazole (PubChem CID 123759738) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is (5R,6aR)-3-bromo-5-phenylmethoxy-4,5,6,6a-tetrahydro-2H-cyclopenta[d][1,2]oxazole.
| Compound Name | (5R,6aR)-3-bromo-5-phenylmethoxy-4,5,6,6a-tetrahydro-2H-cyclopenta[d][1,2]oxazole |
|---|---|
| PubChem CID | 123759738 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | (5R,6aR)-3-bromo-5-phenylmethoxy-4,5,6,6a-tetrahydro-2H-cyclopenta[d][1,2]oxazole |
| SMILES | BrC1=C2C[C@@H](OCc3ccccc3)C[C@H]2ON1 |
| InChI | InChI=1S/C13H14BrNO2/c14-13-11-6-10(7-12(11)17-15-13)16-8-9-4-2-1-3-5-9/h1-5,10,12,15H,6-8H2/t10-,12-/m1/s1 |
| InChIKey | WMMLRFOOYSSTAL-ZYHUDNBSSA-N |
| XLogP | 2.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|