C25H33N3 — CID 123759980
8-ethenyl-8,9,9-triethyl-11-propan-2-yl-1,11,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12(17),13,15-hexaene (PubChem CID 123759980) has the molecular formula C25H33N3 and a molecular weight of 375.56 g/mol. Its IUPAC name is 8-ethenyl-8,9,9-triethyl-11-propan-2-yl-1,11,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12(17),13,15-hexaene.
| Compound Name | 8-ethenyl-8,9,9-triethyl-11-propan-2-yl-1,11,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12(17),13,15-hexaene |
|---|---|
| PubChem CID | 123759980 |
| Molecular Formula | C25H33N3 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | 8-ethenyl-8,9,9-triethyl-11-propan-2-yl-1,11,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12(17),13,15-hexaene |
| SMILES | C=CC1(CC)c2ccccc2N2c3ncccc3N(C(C)C)C2C1(CC)CC |
| InChI | InChI=1S/C25H33N3/c1-7-24(8-2)19-14-11-12-15-20(19)28-22-21(16-13-17-26-22)27(18(5)6)23(28)25(24,9-3)10-4/h7,11-18,23H,1,8-10H2,2-6H3 |
| InChIKey | AEBZVLXOCNBQAP-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|