C23H32N4 — CID 123482933
8,8,9-triethyl-9-methyl-11-propan-2-yl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene (PubChem CID 123482933) has the molecular formula C23H32N4 and a molecular weight of 364.54 g/mol. Its IUPAC name is 8,8,9-triethyl-9-methyl-11-propan-2-yl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene.
| Compound Name | 8,8,9-triethyl-9-methyl-11-propan-2-yl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
|---|---|
| PubChem CID | 123482933 |
| Molecular Formula | C23H32N4 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 8,8,9-triethyl-9-methyl-11-propan-2-yl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
| SMILES | CCC1(CC)c2ccccc2N2c3nccnc3N(C(C)C)C2C1(C)CC |
| InChI | InChI=1S/C23H32N4/c1-7-22(6)21-26(16(4)5)19-20(25-15-14-24-19)27(21)18-13-11-10-12-17(18)23(22,8-2)9-3/h10-16,21H,7-9H2,1-6H3 |
| InChIKey | JZHYQJNXTGZNND-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |